C18H16F4N4 — CID 38559597
3-fluoro-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 38559597) has the molecular formula C18H16F4N4 and a molecular weight of 364.35 g/mol. Its IUPAC name is 3-fluoro-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 38559597 |
| Molecular Formula | C18H16F4N4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-fluoro-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(c3ccc(C(F)(F)F)cn3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H16F4N4/c19-16-9-13(10-23)1-2-14(16)12-25-5-7-26(8-6-25)17-4-3-15(11-24-17)18(20,21)22/h1-4,9,11H,5-8,12H2 |
| InChIKey | VCVZGXNKGIMGCK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |