C17H14F4N4 — CID 126697855
3-fluoro-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzonitrile (PubChem CID 126697855) has the molecular formula C17H14F4N4 and a molecular weight of 350.32 g/mol. Its IUPAC name is 3-fluoro-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 126697855 |
| Molecular Formula | C17H14F4N4 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-fluoro-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(c3ccc(C(F)(F)F)cn3)CC2)c(F)c1 |
| InChI | InChI=1S/C17H14F4N4/c18-14-9-12(10-22)1-3-15(14)24-5-7-25(8-6-24)16-4-2-13(11-23-16)17(19,20)21/h1-4,9,11H,5-8H2 |
| InChIKey | JTSYPIQLIKTWFW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |