C16H15F4N3 — CID 3702315
1-(4-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 3702315) has the molecular formula C16H15F4N3 and a molecular weight of 325.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 3702315 |
| Molecular Formula | C16H15F4N3 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | Fc1ccc(N2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C16H15F4N3/c17-13-2-4-14(5-3-13)22-7-9-23(10-8-22)15-6-1-12(11-21-15)16(18,19)20/h1-6,11H,7-10H2 |
| InChIKey | LVFJQCQDXWCVGX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |