C18H19F4N3O — CID 7189249
(1R)-1-(4-fluorophenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol (PubChem CID 7189249) has the molecular formula C18H19F4N3O and a molecular weight of 369.36 g/mol. Its IUPAC name is (1R)-1-(4-fluorophenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol.
| Compound Name | (1R)-1-(4-fluorophenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 7189249 |
| Molecular Formula | C18H19F4N3O |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (1R)-1-(4-fluorophenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol |
| SMILES | O[C@@H](CN1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F4N3O/c19-15-4-1-13(2-5-15)16(26)12-24-7-9-25(10-8-24)17-6-3-14(11-23-17)18(20,21)22/h1-6,11,16,26H,7-10,12H2/t16-/m0/s1 |
| InChIKey | SLMFDDNVBSTACX-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |