C17H17ClF3N3 — CID 45277944
1-[(4-chlorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 45277944) has the molecular formula C17H17ClF3N3 and a molecular weight of 355.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 45277944 |
| Molecular Formula | C17H17ClF3N3 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCN(Cc3ccc(Cl)cc3)CC2)nc1 |
| InChI | InChI=1S/C17H17ClF3N3/c18-15-4-1-13(2-5-15)12-23-7-9-24(10-8-23)16-6-3-14(11-22-16)17(19,20)21/h1-6,11H,7-10,12H2 |
| InChIKey | WLFJDEMRKUWRBW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |