C15H18F3N5 — CID 47521346
1-(2-pyrazol-1-ylethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 47521346) has the molecular formula C15H18F3N5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 1-(2-pyrazol-1-ylethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(2-pyrazol-1-ylethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 47521346 |
| Molecular Formula | C15H18F3N5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-(2-pyrazol-1-ylethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCN(CCn3cccn3)CC2)nc1 |
| InChI | InChI=1S/C15H18F3N5/c16-15(17,18)13-2-3-14(19-12-13)22-9-6-21(7-10-22)8-11-23-5-1-4-20-23/h1-5,12H,6-11H2 |
| InChIKey | KZNZVUOBFKKUQY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |