C15H22BrFN2 — CID 61057200
1-[(4-bromo-2-fluorophenyl)methyl]-4-tert-butylpiperazine (PubChem CID 61057200) has the molecular formula C15H22BrFN2 and a molecular weight of 329.26 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-4-tert-butylpiperazine.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-tert-butylpiperazine |
|---|---|
| PubChem CID | 61057200 |
| Molecular Formula | C15H22BrFN2 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-tert-butylpiperazine |
| SMILES | CC(C)(C)N1CCN(Cc2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C15H22BrFN2/c1-15(2,3)19-8-6-18(7-9-19)11-12-4-5-13(16)10-14(12)17/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | ATHTVUVLMOBDGO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |