C10H12BrFN2 — CID 65245079
1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-amine (PubChem CID 65245079) has the molecular formula C10H12BrFN2 and a molecular weight of 259.12 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-amine.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-amine |
|---|---|
| PubChem CID | 65245079 |
| Molecular Formula | C10H12BrFN2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-amine |
| SMILES | NC1CN(Cc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C10H12BrFN2/c11-8-2-1-7(10(12)3-8)4-14-5-9(13)6-14/h1-3,9H,4-6,13H2 |
| InChIKey | WZDJFHJTDFIHFG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |