C17H17Br2F2NO2 — CID 159320110
(4-bromo-2-fluorophenyl)methanol;1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-ol (PubChem CID 159320110) has the molecular formula C17H17Br2F2NO2 and a molecular weight of 465.13 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methanol;1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-ol.
| Compound Name | (4-bromo-2-fluorophenyl)methanol;1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 159320110 |
| Molecular Formula | C17H17Br2F2NO2 |
| Molecular Weight | 465.13 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methanol;1-[(4-bromo-2-fluorophenyl)methyl]azetidin-3-ol |
| SMILES | OC1CN(Cc2ccc(Br)cc2F)C1.OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C10H11BrFNO.C7H6BrFO/c11-8-2-1-7(10(12)3-8)4-13-5-9(14)6-13;8-6-2-1-5(4-10)7(9)3-6/h1-3,9,14H,4-6H2;1-3,10H,4H2 |
| InChIKey | LDQPNSSUONPYOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |