C16H20F3N3O2 — CID 165434630
morpholin-4-yl-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone (PubChem CID 165434630) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is morpholin-4-yl-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone.
| Compound Name | morpholin-4-yl-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 165434630 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | morpholin-4-yl-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C16H20F3N3O2/c17-16(18,19)13-1-2-14(20-11-13)21-5-3-12(4-6-21)15(23)22-7-9-24-10-8-22/h1-2,11-12H,3-10H2 |
| InChIKey | IOZHAGLMZASTTC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |