C18H17F3N2O2 — CID 2822230
phenyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 2822230) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is phenyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | phenyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2822230 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | phenyl 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccccc1)C1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C18H17F3N2O2/c19-18(20,21)14-6-7-16(22-12-14)23-10-8-13(9-11-23)17(24)25-15-4-2-1-3-5-15/h1-7,12-13H,8-11H2 |
| InChIKey | KPRNTLZWEAQATQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|