C16H19F4N3O2 — CID 165431893
[1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 165431893) has the molecular formula C16H19F4N3O2 and a molecular weight of 361.34 g/mol. Its IUPAC name is [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 165431893 |
| Molecular Formula | C16H19F4N3O2 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(c2ncc(C(F)(F)F)cc2F)CC1)N1CCOCC1 |
| InChI | InChI=1S/C16H19F4N3O2/c17-13-9-12(16(18,19)20)10-21-14(13)22-3-1-11(2-4-22)15(24)23-5-7-25-8-6-23/h9-11H,1-8H2 |
| InChIKey | XSQUTRWLPXWGHF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |