C11H12F4N2 — CID 59514574
3-fluoro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine (PubChem CID 59514574) has the molecular formula C11H12F4N2 and a molecular weight of 248.22 g/mol. Its IUPAC name is 3-fluoro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine.
| Compound Name | 3-fluoro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 59514574 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-fluoro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine |
| SMILES | Fc1cc(C(F)(F)F)cnc1N1CCCCC1 |
| InChI | InChI=1S/C11H12F4N2/c12-9-6-8(11(13,14)15)7-16-10(9)17-4-2-1-3-5-17/h6-7H,1-5H2 |
| InChIKey | HGJXZVYOBOZPOI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |