C12H13F4N3O2 — CID 175142260
[1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl] carbamate (PubChem CID 175142260) has the molecular formula C12H13F4N3O2 and a molecular weight of 307.25 g/mol. Its IUPAC name is [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl] carbamate.
| Compound Name | [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175142260 |
| Molecular Formula | C12H13F4N3O2 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCCN(c2ncc(C(F)(F)F)cc2F)C1 |
| InChI | InChI=1S/C12H13F4N3O2/c13-9-4-7(12(14,15)16)5-18-10(9)19-3-1-2-8(6-19)21-11(17)20/h4-5,8H,1-3,6H2,(H2,17,20) |
| InChIKey | DQWHKEYORMZPTK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |