C13H16F3N3O3 — CID 175142659
[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-3-yl] carbamate (PubChem CID 175142659) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is [1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-3-yl] carbamate.
| Compound Name | [1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175142659 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCCN(c2cccc(OCC(F)(F)F)n2)C1 |
| InChI | InChI=1S/C13H16F3N3O3/c14-13(15,16)8-21-11-5-1-4-10(18-11)19-6-2-3-9(7-19)22-12(17)20/h1,4-5,9H,2-3,6-8H2,(H2,17,20) |
| InChIKey | RKIQAYMAMBUTQA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |