C13H14ClF3N2O3 — CID 175147504
[(3R)-1-[2-chloro-4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbamate (PubChem CID 175147504) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is [(3R)-1-[2-chloro-4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbamate.
| Compound Name | [(3R)-1-[2-chloro-4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175147504 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [(3R)-1-[2-chloro-4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCN(c2ccc(OC(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c14-10-6-8(22-13(15,16)17)3-4-11(10)19-5-1-2-9(7-19)21-12(18)20/h3-4,6,9H,1-2,5,7H2,(H2,18,20)/t9-/m1/s1 |
| InChIKey | UNFZVCUQTGSJAJ-SECBINFHSA-N |
| XLogP | 3.30 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|