C12H12F4N2O2 — CID 175140042
[1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] carbamate (PubChem CID 175140042) has the molecular formula C12H12F4N2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is [1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] carbamate.
| Compound Name | [1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175140042 |
| Molecular Formula | C12H12F4N2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2ccc(C(F)(F)F)cc2F)C1 |
| InChI | InChI=1S/C12H12F4N2O2/c13-9-5-7(12(14,15)16)1-2-10(9)18-4-3-8(6-18)20-11(17)19/h1-2,5,8H,3-4,6H2,(H2,17,19) |
| InChIKey | FXRBOLKKASVPNY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |