C21H23F4N — CID 155764118
1-(4-tert-butyl-2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 155764118) has the molecular formula C21H23F4N and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-(4-tert-butyl-2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 1-(4-tert-butyl-2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 155764118 |
| Molecular Formula | C21H23F4N |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-(4-tert-butyl-2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | CC(C)(C)c1ccc(N2CCC(c3ccc(C(F)(F)F)cc3)C2)c(F)c1 |
| InChI | InChI=1S/C21H23F4N/c1-20(2,3)17-8-9-19(18(22)12-17)26-11-10-15(13-26)14-4-6-16(7-5-14)21(23,24)25/h4-9,12,15H,10-11,13H2,1-3H3 |
| InChIKey | IWQQMGREUFDIME-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |