C27H42FN3 — CID 59295645
5-[1-(4-tert-butyl-2-fluorophenyl)piperidin-4-yl]-2-cyclohexyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 59295645) has the molecular formula C27H42FN3 and a molecular weight of 427.65 g/mol. Its IUPAC name is 5-[1-(4-tert-butyl-2-fluorophenyl)piperidin-4-yl]-2-cyclohexyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-(4-tert-butyl-2-fluorophenyl)piperidin-4-yl]-2-cyclohexyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 59295645 |
| Molecular Formula | C27H42FN3 |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | 5-[1-(4-tert-butyl-2-fluorophenyl)piperidin-4-yl]-2-cyclohexyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)c1ccc(N2CCC(N3CC4CN(C5CCCCC5)CC4C3)CC2)c(F)c1 |
| InChI | InChI=1S/C27H42FN3/c1-27(2,3)22-9-10-26(25(28)15-22)29-13-11-24(12-14-29)31-18-20-16-30(17-21(20)19-31)23-7-5-4-6-8-23/h9-10,15,20-21,23-24H,4-8,11-14,16-19H2,1-3H3 |
| InChIKey | KZHNQUPWJZFNMA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |