C19H31FN2 — CID 143719363
1-cyclohexyl-4-(2-fluorophenyl)piperazine;propane (PubChem CID 143719363) has the molecular formula C19H31FN2 and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2-fluorophenyl)piperazine;propane.
| Compound Name | 1-cyclohexyl-4-(2-fluorophenyl)piperazine;propane |
|---|---|
| PubChem CID | 143719363 |
| Molecular Formula | C19H31FN2 |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 1-cyclohexyl-4-(2-fluorophenyl)piperazine;propane |
| SMILES | CCC.Fc1ccccc1N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H23FN2.C3H8/c17-15-8-4-5-9-16(15)19-12-10-18(11-13-19)14-6-2-1-3-7-14;1-3-2/h4-5,8-9,14H,1-3,6-7,10-13H2;3H2,1-2H3 |
| InChIKey | NFRNYVIDLGCNOA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |