C18H29N3 — CID 62369129
N-[[2-(4-cyclopentylpiperazin-1-yl)phenyl]methyl]ethanamine (PubChem CID 62369129) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[[2-(4-cyclopentylpiperazin-1-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[2-(4-cyclopentylpiperazin-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62369129 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N-[[2-(4-cyclopentylpiperazin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccccc1N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C18H29N3/c1-2-19-15-16-7-3-6-10-18(16)21-13-11-20(12-14-21)17-8-4-5-9-17/h3,6-7,10,17,19H,2,4-5,8-9,11-15H2,1H3 |
| InChIKey | AISDIXACHLWEKR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |