C16H24ClN3 — CID 114849168
N-[[4-chloro-2-(4-cyclopropylpiperazin-1-yl)phenyl]methyl]ethanamine (PubChem CID 114849168) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is N-[[4-chloro-2-(4-cyclopropylpiperazin-1-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[4-chloro-2-(4-cyclopropylpiperazin-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114849168 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[[4-chloro-2-(4-cyclopropylpiperazin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(Cl)cc1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C16H24ClN3/c1-2-18-12-13-3-4-14(17)11-16(13)20-9-7-19(8-10-20)15-5-6-15/h3-4,11,15,18H,2,5-10,12H2,1H3 |
| InChIKey | BOBIXGCXPOGEFO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |