C16H22FN3S — CID 79515253
2-(4-cyclopentylpiperazin-1-yl)-6-fluorobenzenecarbothioamide (PubChem CID 79515253) has the molecular formula C16H22FN3S and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-(4-cyclopentylpiperazin-1-yl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(4-cyclopentylpiperazin-1-yl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 79515253 |
| Molecular Formula | C16H22FN3S |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(4-cyclopentylpiperazin-1-yl)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H22FN3S/c17-13-6-3-7-14(15(13)16(18)21)20-10-8-19(9-11-20)12-4-1-2-5-12/h3,6-7,12H,1-2,4-5,8-11H2,(H2,18,21) |
| InChIKey | IGDXFGUBVZWDFJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|