C14H17FN2S — CID 113335719
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-fluorobenzenecarbothioamide (PubChem CID 113335719) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 113335719 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H17FN2S/c15-11-5-2-6-12(13(11)14(16)18)17-7-9-3-1-4-10(9)8-17/h2,5-6,9-10H,1,3-4,7-8H2,(H2,16,18) |
| InChIKey | HDYUGJNAPHYDLS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|