C16H23FN2 — CID 26458018
1-(2-fluorophenyl)-4-[(1R,3R)-3-methylcyclopentyl]piperazine (PubChem CID 26458018) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(1R,3R)-3-methylcyclopentyl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[(1R,3R)-3-methylcyclopentyl]piperazine |
|---|---|
| PubChem CID | 26458018 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(1R,3R)-3-methylcyclopentyl]piperazine |
| SMILES | C[C@@H]1CC[C@@H](N2CCN(c3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C16H23FN2/c1-13-6-7-14(12-13)18-8-10-19(11-9-18)16-5-3-2-4-15(16)17/h2-5,13-14H,6-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | MVZYFQAJTIFKAW-ZIAGYGMSSA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |