C17H26N2O — CID 782078
1-(2-methoxyphenyl)-4-[(1S,3R)-3-methylcyclopentyl]piperazine (PubChem CID 782078) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[(1S,3R)-3-methylcyclopentyl]piperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-[(1S,3R)-3-methylcyclopentyl]piperazine |
|---|---|
| PubChem CID | 782078 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[(1S,3R)-3-methylcyclopentyl]piperazine |
| SMILES | COc1ccccc1N1CCN([C@H]2CC[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C17H26N2O/c1-14-7-8-15(13-14)18-9-11-19(12-10-18)16-5-3-4-6-17(16)20-2/h3-6,14-15H,7-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | UIXAGJDENQATEF-CABCVRRESA-N |
| XLogP | 3.01 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |