C22H28FN3O3S — CID 1334438
1-(2-fluorophenyl)-4-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]piperazine (PubChem CID 1334438) has the molecular formula C22H28FN3O3S and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 1334438 |
| Molecular Formula | C22H28FN3O3S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(N3CCN(c4ccccc4F)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H28FN3O3S/c1-29-19-6-8-20(9-7-19)30(27,28)26-12-10-18(11-13-26)24-14-16-25(17-15-24)22-5-3-2-4-21(22)23/h2-9,18H,10-17H2,1H3 |
| InChIKey | DJAZBQMPUFUZRN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |