C22H23FN2O3S — CID 1041679
1-(6-ethoxynaphthalen-2-yl)sulfonyl-4-(2-fluorophenyl)piperazine (PubChem CID 1041679) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-(6-ethoxynaphthalen-2-yl)sulfonyl-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-(6-ethoxynaphthalen-2-yl)sulfonyl-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1041679 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(6-ethoxynaphthalen-2-yl)sulfonyl-4-(2-fluorophenyl)piperazine |
| SMILES | CCOc1ccc2cc(S(=O)(=O)N3CCN(c4ccccc4F)CC3)ccc2c1 |
| InChI | InChI=1S/C22H23FN2O3S/c1-2-28-19-9-7-18-16-20(10-8-17(18)15-19)29(26,27)25-13-11-24(12-14-25)22-6-4-3-5-21(22)23/h3-10,15-16H,2,11-14H2,1H3 |
| InChIKey | DVZMGFDQUGBQNO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |