C29H30N2O3S — CID 2868886
1-benzhydryl-4-(6-ethoxynaphthalen-2-yl)sulfonylpiperazine (PubChem CID 2868886) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 1-benzhydryl-4-(6-ethoxynaphthalen-2-yl)sulfonylpiperazine.
| Compound Name | 1-benzhydryl-4-(6-ethoxynaphthalen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2868886 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-benzhydryl-4-(6-ethoxynaphthalen-2-yl)sulfonylpiperazine |
| SMILES | CCOc1ccc2cc(S(=O)(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)ccc2c1 |
| InChI | InChI=1S/C29H30N2O3S/c1-2-34-27-15-13-26-22-28(16-14-25(26)21-27)35(32,33)31-19-17-30(18-20-31)29(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-16,21-22,29H,2,17-20H2,1H3 |
| InChIKey | UADCPJRCUSGCSU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |