C33H34N4O4S2 — CID 4949091
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-4-ethoxybenzamide (PubChem CID 4949091) has the molecular formula C33H34N4O4S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-4-ethoxybenzamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 4949091 |
| Molecular Formula | C33H34N4O4S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O4S2/c1-2-41-29-17-13-27(14-18-29)32(38)35-33(42)34-28-15-19-30(20-16-28)43(39,40)37-23-21-36(22-24-37)31(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-20,31H,2,21-24H2,1H3,(H2,34,35,38,42) |
| InChIKey | CSCAGNXYYCQQOT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|