C32H31ClN4O3S2 — CID 4946637
N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 4946637) has the molecular formula C32H31ClN4O3S2 and a molecular weight of 619.21 g/mol. Its IUPAC name is N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4946637 |
| Molecular Formula | C32H31ClN4O3S2 |
| Molecular Weight | 619.21 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | N-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H31ClN4O3S2/c33-27-13-11-24(12-14-27)23-30(38)35-32(41)34-28-15-17-29(18-16-28)42(39,40)37-21-19-36(20-22-37)31(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-18,31H,19-23H2,(H2,34,35,38,41) |
| InChIKey | RFUTYWVLCJMTLZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.21 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|