C24H26N4O3S2 — CID 4778586
N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide (PubChem CID 4778586) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4778586 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]-2-naphthalen-1-ylacetamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)Cc3cccc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-27-13-15-28(16-14-27)33(30,31)21-11-9-20(10-12-21)25-24(32)26-23(29)17-19-7-4-6-18-5-2-3-8-22(18)19/h2-12H,13-17H2,1H3,(H2,25,26,29,32) |
| InChIKey | ZBVQTSWMUDRUCA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|