C22H21N3O2S — CID 17231499
N,N-dimethyl-4-[(2-naphthalen-1-ylacetyl)carbamothioylamino]benzamide (PubChem CID 17231499) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2-naphthalen-1-ylacetyl)carbamothioylamino]benzamide.
| Compound Name | N,N-dimethyl-4-[(2-naphthalen-1-ylacetyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17231499 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N,N-dimethyl-4-[(2-naphthalen-1-ylacetyl)carbamothioylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=S)NC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-25(2)21(27)16-10-12-18(13-11-16)23-22(28)24-20(26)14-17-8-5-7-15-6-3-4-9-19(15)17/h3-13H,14H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | BZXIBWLJMZHXJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|