C22H22N2O2 — CID 46424485
N,N-dimethyl-3-[[(2-naphthalen-1-ylacetyl)amino]methyl]benzamide (PubChem CID 46424485) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(2-naphthalen-1-ylacetyl)amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-3-[[(2-naphthalen-1-ylacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 46424485 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N,N-dimethyl-3-[[(2-naphthalen-1-ylacetyl)amino]methyl]benzamide |
| SMILES | CN(C)C(=O)c1cccc(CNC(=O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-24(2)22(26)19-11-5-7-16(13-19)15-23-21(25)14-18-10-6-9-17-8-3-4-12-20(17)18/h3-13H,14-15H2,1-2H3,(H,23,25) |
| InChIKey | VALMBFIDKWJPSZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |