C11H16N2O — CID 83814364
N,N-dimethyl-3-(methylaminomethyl)benzamide (PubChem CID 83814364) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N,N-dimethyl-3-(methylaminomethyl)benzamide.
| Compound Name | N,N-dimethyl-3-(methylaminomethyl)benzamide |
|---|---|
| PubChem CID | 83814364 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N,N-dimethyl-3-(methylaminomethyl)benzamide |
| SMILES | CNCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C11H16N2O/c1-12-8-9-5-4-6-10(7-9)11(14)13(2)3/h4-7,12H,8H2,1-3H3 |
| InChIKey | PEXYWBODRPIJKD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |