C20H18N2OS — CID 920719
N-(benzylcarbamothioyl)-2-naphthalen-1-ylacetamide (PubChem CID 920719) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(benzylcarbamothioyl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(benzylcarbamothioyl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 920719 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(benzylcarbamothioyl)-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C20H18N2OS/c23-19(22-20(24)21-14-15-7-2-1-3-8-15)13-17-11-6-10-16-9-4-5-12-18(16)17/h1-12H,13-14H2,(H2,21,22,23,24) |
| InChIKey | YIQIJUTVQJWTPP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|