C13H12N2OS — CID 150600565
N-carbamothioyl-2-naphthalen-1-ylacetamide (PubChem CID 150600565) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is N-carbamothioyl-2-naphthalen-1-ylacetamide.
| Compound Name | N-carbamothioyl-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 150600565 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-carbamothioyl-2-naphthalen-1-ylacetamide |
| SMILES | NC(=S)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C13H12N2OS/c14-13(17)15-12(16)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H3,14,15,16,17) |
| InChIKey | IRTYKYODZBRMMU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|