C16H17NO3 — CID 2079406
methyl (2R)-2-[(2-naphthalen-1-ylacetyl)amino]propanoate (PubChem CID 2079406) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl (2R)-2-[(2-naphthalen-1-ylacetyl)amino]propanoate.
| Compound Name | methyl (2R)-2-[(2-naphthalen-1-ylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 2079406 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl (2R)-2-[(2-naphthalen-1-ylacetyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C16H17NO3/c1-11(16(19)20-2)17-15(18)10-13-8-5-7-12-6-3-4-9-14(12)13/h3-9,11H,10H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | JZZQHBROKOHAQW-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |