C23H23NO3 — CID 9138862
phenyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate (PubChem CID 9138862) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is phenyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate.
| Compound Name | phenyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 9138862 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | phenyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C23H23NO3/c1-16(2)22(23(26)27-19-12-4-3-5-13-19)24-21(25)15-18-11-8-10-17-9-6-7-14-20(17)18/h3-14,16,22H,15H2,1-2H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | NQGWQSBBSZOEDN-QFIPXVFZSA-N |
| XLogP | 4.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|