C25H24FNO4 — CID 8847651
[2-(4-fluorophenyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate (PubChem CID 8847651) has the molecular formula C25H24FNO4 and a molecular weight of 421.47 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8847651 |
| Molecular Formula | C25H24FNO4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FNO4/c1-16(2)24(25(30)31-15-22(28)18-10-12-20(26)13-11-18)27-23(29)14-19-8-5-7-17-6-3-4-9-21(17)19/h3-13,16,24H,14-15H2,1-2H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | MEHJMAUSXYDWCY-DEOSSOPVSA-N |
| XLogP | 4.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |