C23H28N2O4 — CID 8563039
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate (PubChem CID 8563039) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 8563039 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)Cc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C23H28N2O4/c1-5-13-24-22(27)16(4)29-23(28)21(15(2)3)25-20(26)14-18-11-8-10-17-9-6-7-12-19(17)18/h5-12,15-16,21H,1,13-14H2,2-4H3,(H,24,27)(H,25,26)/t16-,21-/m0/s1 |
| InChIKey | WZQHUOOUFLZQFI-KKSFZXQISA-N |
| XLogP | 2.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|