C27H32N2O2 — CID 7610874
(2S)-N-(4-tert-butylphenyl)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanamide (PubChem CID 7610874) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (2S)-N-(4-tert-butylphenyl)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanamide.
| Compound Name | (2S)-N-(4-tert-butylphenyl)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 7610874 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (2S)-N-(4-tert-butylphenyl)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanamide |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-18(2)25(26(31)28-22-15-13-21(14-16-22)27(3,4)5)29-24(30)17-20-11-8-10-19-9-6-7-12-23(19)20/h6-16,18,25H,17H2,1-5H3,(H,28,31)(H,29,30)/t25-/m0/s1 |
| InChIKey | LETMJWWTISXJKP-VWLOTQADSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |