C25H26FNO4 — CID 7572927
2-(4-fluorophenoxy)ethyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate (PubChem CID 7572927) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate.
| Compound Name | 2-(4-fluorophenoxy)ethyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 7572927 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl (2S)-3-methyl-2-[(2-naphthalen-1-ylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO4/c1-17(2)24(25(29)31-15-14-30-21-12-10-20(26)11-13-21)27-23(28)16-19-8-5-7-18-6-3-4-9-22(18)19/h3-13,17,24H,14-16H2,1-2H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | WBMMJMFQUFKTIL-DEOSSOPVSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|