C24H26N2O3S — CID 54777169
N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-2-naphthalen-1-ylacetamide (PubChem CID 54777169) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 54777169 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]-2-naphthalen-1-ylacetamide |
| SMILES | CCCOc1ccc(CNC(=S)NC(=O)Cc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C24H26N2O3S/c1-3-13-29-21-12-11-17(14-22(21)28-2)16-25-24(30)26-23(27)15-19-9-6-8-18-7-4-5-10-20(18)19/h4-12,14H,3,13,15-16H2,1-2H3,(H2,25,26,27,30) |
| InChIKey | VNNJSUAXUVKHSI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|