C22H26Cl2N2O4S — CID 54777247
4-(2,4-dichlorophenoxy)-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]butanamide (PubChem CID 54777247) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]butanamide |
|---|---|
| PubChem CID | 54777247 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(3-methoxy-4-propoxyphenyl)methylcarbamothioyl]butanamide |
| SMILES | CCCOc1ccc(CNC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C22H26Cl2N2O4S/c1-3-10-29-19-8-6-15(12-20(19)28-2)14-25-22(31)26-21(27)5-4-11-30-18-9-7-16(23)13-17(18)24/h6-9,12-13H,3-5,10-11,14H2,1-2H3,(H2,25,26,27,31) |
| InChIKey | KOIWQJYSZNCZFH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|