C18H18Cl2FN3O2S — CID 17374991
1-[4-(2,4-dichlorophenoxy)butanoylamino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 17374991) has the molecular formula C18H18Cl2FN3O2S and a molecular weight of 430.33 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenoxy)butanoylamino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[4-(2,4-dichlorophenoxy)butanoylamino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 17374991 |
| Molecular Formula | C18H18Cl2FN3O2S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-[4-(2,4-dichlorophenoxy)butanoylamino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18Cl2FN3O2S/c19-13-5-8-16(15(20)10-13)26-9-1-2-17(25)23-24-18(27)22-11-12-3-6-14(21)7-4-12/h3-8,10H,1-2,9,11H2,(H,23,25)(H2,22,24,27) |
| InChIKey | NRDLTGUGSXHOIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|