C15H21Cl2N3O2S — CID 9425938
1-tert-butyl-3-[4-(2,4-dichlorophenoxy)butanoylamino]thiourea (PubChem CID 9425938) has the molecular formula C15H21Cl2N3O2S and a molecular weight of 378.33 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(2,4-dichlorophenoxy)butanoylamino]thiourea.
| Compound Name | 1-tert-butyl-3-[4-(2,4-dichlorophenoxy)butanoylamino]thiourea |
|---|---|
| PubChem CID | 9425938 |
| Molecular Formula | C15H21Cl2N3O2S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 1-tert-butyl-3-[4-(2,4-dichlorophenoxy)butanoylamino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O2S/c1-15(2,3)18-14(23)20-19-13(21)5-4-8-22-12-7-6-10(16)9-11(12)17/h6-7,9H,4-5,8H2,1-3H3,(H,19,21)(H2,18,20,23) |
| InChIKey | QDZVEGIISGTVQU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|