C18H23Cl2N3O5S — CID 4933729
propyl 4-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4933729) has the molecular formula C18H23Cl2N3O5S and a molecular weight of 464.37 g/mol. Its IUPAC name is propyl 4-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4933729 |
| Molecular Formula | C18H23Cl2N3O5S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | propyl 4-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H23Cl2N3O5S/c1-2-9-28-17(26)8-7-15(24)21-18(29)23-22-16(25)4-3-10-27-14-6-5-12(19)11-13(14)20/h5-6,11H,2-4,7-10H2,1H3,(H,22,25)(H2,21,23,24,29) |
| InChIKey | OGIYNPKYLDJVLQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|