C17H16Cl2N4O3S — CID 4500973
4-(2,4-dichlorophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]butanamide (PubChem CID 4500973) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 4500973 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(pyridine-4-carbonylamino)carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c18-12-3-4-14(13(19)10-12)26-9-1-2-15(24)21-17(27)23-22-16(25)11-5-7-20-8-6-11/h3-8,10H,1-2,9H2,(H,22,25)(H2,21,23,24,27) |
| InChIKey | DPCCNYRDGAXLCW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|