C18H16Cl2N4O5S — CID 4500960
4-(2,4-dichlorophenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]butanamide (PubChem CID 4500960) has the molecular formula C18H16Cl2N4O5S and a molecular weight of 471.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 4500960 |
| Molecular Formula | C18H16Cl2N4O5S |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[[(2-nitrobenzoyl)amino]carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16Cl2N4O5S/c19-11-7-8-15(13(20)10-11)29-9-3-6-16(25)21-18(30)23-22-17(26)12-4-1-2-5-14(12)24(27)28/h1-2,4-5,7-8,10H,3,6,9H2,(H,22,26)(H2,21,23,25,30) |
| InChIKey | DHAJCROPOFBPST-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|